| Name | m-anisoyl chloride |
| Synonyms | AKOS BBS-00003914 m-anisoyl chloride M-ANISOYL CHLORIDE 3-Anisoyl Chloride 3-ANISOYL CHLORIDE M-ANISIC ACID CHLORIDE M-Fluorobenzoyl Chloride M-METHOXYBENZOYL CHLORIDE 3-methoxybenzoyl chloride 3-METHOXYBENZOYL CHLORIDE M-Methoxybenzoyl Chloride Benzoyl chloride, m-methoxy- |
| CAS | 1711-05-3 |
| EINECS | 216-975-2 |
| InChI | InChI=1/C8H7ClO2/c1-11-7-4-2-3-6(5-7)8(9)10/h2-5H,1H3 |
| Molecular Formula | C8H7ClO2 |
| Molar Mass | 170.59 |
| Density | 1.214g/mLat 25°C(lit.) |
| Boling Point | 123-125°C15mm Hg(lit.) |
| Flash Point | 198°F |
| Water Solubility | Soluble in chloroform. Reacts with water. |
| Solubility | Chloroform (Slightly), Ethyl Acetate (Slightly) |
| Vapor Presure | 0.0308mmHg at 25°C |
| Appearance | Liquid |
| Specific Gravity | 1.214 |
| Color | Clear colorless to light yellow |
| BRN | 386659 |
| Storage Condition | Inert atmosphere,Room Temperature |
| Sensitive | Moisture Sensitive |
| Refractive Index | n20/D 1.558(lit.) |
| Hazard Symbols | C - Corrosive![]() |
| Risk Codes | R34 - Causes burns R36/37 - Irritating to eyes and respiratory system. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36/37/39 - Wear suitable protective clothing, gloves and eye/face protection. S45 - In case of accident or if you feel unwell, seek medical advice immediately (show the label whenever possible.) |
| UN IDs | UN 1729 8/PG 2 |
| WGK Germany | 3 |
| FLUKA BRAND F CODES | 10-19-21 |
| HS Code | 29147000 |
| Hazard Class | 8 |
| Packing Group | II |
| Use | 3-methoxybenzyl Chloride is used in the synthesis of 2-arylbenzofuran-based molesthert act. In addition, it aids in the optimization of dihydropyr rolopymidine inhibitors against PI3K (phosphorositide 3-kinase) resultant in tumor growth inhibition. |